C14H20BNO6 — CID 170824995
2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanoic acid (PubChem CID 170824995) has the molecular formula C14H20BNO6 and a molecular weight of 309.13 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanoic acid.
| Compound Name | 2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 170824995 |
| Molecular Formula | C14H20BNO6 |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2,3-dihydroxy-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]propanoic acid |
| SMILES | CC1(C)OB(c2cncc(C(O)C(O)C(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO6/c1-13(2)14(3,4)22-15(21-13)9-5-8(6-16-7-9)10(17)11(18)12(19)20/h5-7,10-11,17-18H,1-4H3,(H,19,20) |
| InChIKey | DBFMSGIVNCVWSG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|