C14H20BNO4S — CID 90833602
2-methylsulfinyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone (PubChem CID 90833602) has the molecular formula C14H20BNO4S and a molecular weight of 309.20 g/mol. Its IUPAC name is 2-methylsulfinyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone.
| Compound Name | 2-methylsulfinyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 90833602 |
| Molecular Formula | C14H20BNO4S |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-methylsulfinyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethanone |
| SMILES | CS(=O)CC(=O)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H20BNO4S/c1-13(2)14(3,4)20-15(19-13)11-6-10(7-16-8-11)12(17)9-21(5)18/h6-8H,9H2,1-5H3 |
| InChIKey | TVWORARQTLEBOD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|