C14H21BN2O3 — CID 59619737
N-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]acetamide (PubChem CID 59619737) has the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. Its IUPAC name is N-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]acetamide.
| Compound Name | N-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59619737 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]acetamide |
| SMILES | CNC(=O)Cc1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H21BN2O3/c1-13(2)14(3,4)20-15(19-13)11-6-10(8-17-9-11)7-12(18)16-5/h6,8-9H,7H2,1-5H3,(H,16,18) |
| InChIKey | BBWGQWCXRPXMPS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|