C17H26BN3O3 — CID 58412363
1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 58412363) has the molecular formula C17H26BN3O3 and a molecular weight of 331.22 g/mol. Its IUPAC name is 1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58412363 |
| Molecular Formula | C17H26BN3O3 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cncc(B3OC(C)(C)C(C)(C)O3)c2)CC1 |
| InChI | InChI=1S/C17H26BN3O3/c1-13(22)20-6-8-21(9-7-20)15-10-14(11-19-12-15)18-23-16(2,3)17(4,5)24-18/h10-12H,6-9H2,1-5H3 |
| InChIKey | AFGNGEILOWYDOZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|