C21H24BClN2O3 — CID 123856682
5-chloro-3,3-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]isoindol-1-one (PubChem CID 123856682) has the molecular formula C21H24BClN2O3 and a molecular weight of 398.70 g/mol. Its IUPAC name is 5-chloro-3,3-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]isoindol-1-one.
| Compound Name | 5-chloro-3,3-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]isoindol-1-one |
|---|---|
| PubChem CID | 123856682 |
| Molecular Formula | C21H24BClN2O3 |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 5-chloro-3,3-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]isoindol-1-one |
| SMILES | CC1(C)c2cc(Cl)ccc2C(=O)N1c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H24BClN2O3/c1-19(2)17-10-14(23)7-8-16(17)18(26)25(19)15-9-13(11-24-12-15)22-27-20(3,4)21(5,6)28-22/h7-12H,1-6H3 |
| InChIKey | NZXRQFMHNUZYPS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|