C15H23BN2O5S — CID 59353593
4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonyl]morpholine (PubChem CID 59353593) has the molecular formula C15H23BN2O5S and a molecular weight of 354.24 g/mol. Its IUPAC name is 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonyl]morpholine.
| Compound Name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonyl]morpholine |
|---|---|
| PubChem CID | 59353593 |
| Molecular Formula | C15H23BN2O5S |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]sulfonyl]morpholine |
| SMILES | CC1(C)OB(c2cncc(S(=O)(=O)N3CCOCC3)c2)OC1(C)C |
| InChI | InChI=1S/C15H23BN2O5S/c1-14(2)15(3,4)23-16(22-14)12-9-13(11-17-10-12)24(19,20)18-5-7-21-8-6-18/h9-11H,5-8H2,1-4H3 |
| InChIKey | DJZHQGHRODEJDJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|