C17H27BN2O4S — CID 165180656
1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidin-3-amine (PubChem CID 165180656) has the molecular formula C17H27BN2O4S and a molecular weight of 366.29 g/mol. Its IUPAC name is 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidin-3-amine.
| Compound Name | 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 165180656 |
| Molecular Formula | C17H27BN2O4S |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrolidin-3-amine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)N2CCC(N)C2)c1 |
| InChI | InChI=1S/C17H27BN2O4S/c1-12-8-13(18-23-16(2,3)17(4,5)24-18)10-15(9-12)25(21,22)20-7-6-14(19)11-20/h8-10,14H,6-7,11,19H2,1-5H3 |
| InChIKey | QZOXMFGRCMNCFQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|