C15H21BFNO4S — CID 90391432
3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylazetidine (PubChem CID 90391432) has the molecular formula C15H21BFNO4S and a molecular weight of 341.21 g/mol. Its IUPAC name is 3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylazetidine.
| Compound Name | 3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylazetidine |
|---|---|
| PubChem CID | 90391432 |
| Molecular Formula | C15H21BFNO4S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylazetidine |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)N3CC(F)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C15H21BFNO4S/c1-14(2)15(3,4)22-16(21-14)11-5-7-13(8-6-11)23(19,20)18-9-12(17)10-18/h5-8,12H,9-10H2,1-4H3 |
| InChIKey | JYFARHKASDNJJD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|