C19H30BNO4S — CID 165341384
1-ethylsulfonyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (PubChem CID 165341384) has the molecular formula C19H30BNO4S and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine.
| Compound Name | 1-ethylsulfonyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 165341384 |
| Molecular Formula | C19H30BNO4S |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-ethylsulfonyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| SMILES | CCS(=O)(=O)N1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C19H30BNO4S/c1-6-26(22,23)21-13-11-16(12-14-21)15-7-9-17(10-8-15)20-24-18(2,3)19(4,5)25-20/h7-10,16H,6,11-14H2,1-5H3 |
| InChIKey | YZGIROFDVLNAOP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|