C12H20BNO4S — CID 53217231
1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (PubChem CID 53217231) has the molecular formula C12H20BNO4S and a molecular weight of 285.17 g/mol. Its IUPAC name is 1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole.
| Compound Name | 1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
|---|---|
| PubChem CID | 53217231 |
| Molecular Formula | C12H20BNO4S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| SMILES | CCS(=O)(=O)n1ccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C12H20BNO4S/c1-6-19(15,16)14-8-7-10(9-14)13-17-11(2,3)12(4,5)18-13/h7-9H,6H2,1-5H3 |
| InChIKey | MIFWZDZTMHOMRV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|