C17H22BNO2 — CID 11231398
1-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (PubChem CID 11231398) has the molecular formula C17H22BNO2 and a molecular weight of 283.18 g/mol. Its IUPAC name is 1-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole.
| Compound Name | 1-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
|---|---|
| PubChem CID | 11231398 |
| Molecular Formula | C17H22BNO2 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-benzyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| SMILES | CC1(C)OB(c2ccn(Cc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C17H22BNO2/c1-16(2)17(3,4)21-18(20-16)15-10-11-19(13-15)12-14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3 |
| InChIKey | ZGHSKJAXSNIWRQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|