C27H34BNO2 — CID 171967174
8-benzyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171967174) has the molecular formula C27H34BNO2 and a molecular weight of 415.39 g/mol. Its IUPAC name is 8-benzyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-benzyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171967174 |
| Molecular Formula | C27H34BNO2 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 8-benzyl-3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | CC1(C)OB(c2ccc(CC3=CC4CCC(C3)N4Cc3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H34BNO2/c1-26(2)27(3,4)31-28(30-26)23-12-10-20(11-13-23)16-22-17-24-14-15-25(18-22)29(24)19-21-8-6-5-7-9-21/h5-13,17,24-25H,14-16,18-19H2,1-4H3 |
| InChIKey | MMOGNQHZLXNGSG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|