C21H30BNO3 — CID 171969551
9-methyl-7-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171969551) has the molecular formula C21H30BNO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is 9-methyl-7-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-methyl-7-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171969551 |
| Molecular Formula | C21H30BNO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 9-methyl-7-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | CN1C2C=C(Cc3cccc(B4OC(C)(C)C(C)(C)O4)c3)CC1COC2 |
| InChI | InChI=1S/C21H30BNO3/c1-20(2)21(3,4)26-22(25-20)17-8-6-7-15(10-17)9-16-11-18-13-24-14-19(12-16)23(18)5/h6-8,10-11,18-19H,9,12-14H2,1-5H3 |
| InChIKey | MGOUABJONLFVJJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|