C17H26BNO3 — CID 150195108
(3R)-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (PubChem CID 150195108) has the molecular formula C17H26BNO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is (3R)-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine.
| Compound Name | (3R)-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 150195108 |
| Molecular Formula | C17H26BNO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3R)-3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| SMILES | CC1(C)OB(c2cccc(C[C@@H]3COCCN3)c2)OC1(C)C |
| InChI | InChI=1S/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)14-7-5-6-13(10-14)11-15-12-20-9-8-19-15/h5-7,10,15,19H,8-9,11-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | FOGZHIUFZFOFPU-OAHLLOKOSA-N |
| XLogP | 1.52 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|