C16H20ClN3O — CID 118936174
(3R)-3-[[3-(4-methylpyrimidin-2-yl)phenyl]methyl]morpholine;hydrochloride (PubChem CID 118936174) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is (3R)-3-[[3-(4-methylpyrimidin-2-yl)phenyl]methyl]morpholine;hydrochloride.
| Compound Name | (3R)-3-[[3-(4-methylpyrimidin-2-yl)phenyl]methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 118936174 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (3R)-3-[[3-(4-methylpyrimidin-2-yl)phenyl]methyl]morpholine;hydrochloride |
| SMILES | Cc1ccnc(-c2cccc(C[C@@H]3COCCN3)c2)n1.Cl |
| InChI | InChI=1S/C16H19N3O.ClH/c1-12-5-6-18-16(19-12)14-4-2-3-13(9-14)10-15-11-20-8-7-17-15;/h2-6,9,15,17H,7-8,10-11H2,1H3;1H/t15-;/m1./s1 |
| InChIKey | AWKIIQUXHPMJOR-XFULWGLBSA-N |
| XLogP | 2.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |