C21H32BNO4 — CID 155744976
(3R)-3-[2-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine (PubChem CID 155744976) has the molecular formula C21H32BNO4 and a molecular weight of 373.30 g/mol. Its IUPAC name is (3R)-3-[2-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine.
| Compound Name | (3R)-3-[2-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 155744976 |
| Molecular Formula | C21H32BNO4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3R)-3-[2-(oxan-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine |
| SMILES | CC1(C)OB(c2ccc(C3CCOCC3)c([C@@H]3COCCN3)c2)OC1(C)C |
| InChI | InChI=1S/C21H32BNO4/c1-20(2)21(3,4)27-22(26-20)16-5-6-17(15-7-10-24-11-8-15)18(13-16)19-14-25-12-9-23-19/h5-6,13,15,19,23H,7-12,14H2,1-4H3/t19-/m0/s1 |
| InChIKey | WARFRCVKJIUSTD-IBGZPJMESA-N |
| XLogP | 2.54 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|