C23H28BNO2 — CID 140838775
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(4-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienyl)pyridine (PubChem CID 140838775) has the molecular formula C23H28BNO2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(4-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienyl)pyridine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(4-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienyl)pyridine |
|---|---|
| PubChem CID | 140838775 |
| Molecular Formula | C23H28BNO2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(4-tricyclo[6.2.2.02,7]dodeca-2(7),3,5-trienyl)pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)C3CCC4CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C23H28BNO2/c1-22(2)23(3,4)27-24(26-22)18-10-12-21(25-14-18)17-9-11-19-15-5-7-16(8-6-15)20(19)13-17/h9-16H,5-8H2,1-4H3 |
| InChIKey | JOUWHGAODLZYLY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|