C21H22BN3O2 — CID 90182370
2-pyridin-3-yl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine (PubChem CID 90182370) has the molecular formula C21H22BN3O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is 2-pyridin-3-yl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine.
| Compound Name | 2-pyridin-3-yl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 90182370 |
| Molecular Formula | C21H22BN3O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-pyridin-3-yl-5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4cccnc4)nc3)nc2)OC1(C)C |
| InChI | InChI=1S/C21H22BN3O2/c1-20(2)21(3,4)27-22(26-20)17-8-10-19(25-14-17)16-7-9-18(24-13-16)15-6-5-11-23-12-15/h5-14H,1-4H3 |
| InChIKey | QYJPFHRFOJXLPW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|