C26H28BNO2 — CID 140826793
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)isoquinoline (PubChem CID 140826793) has the molecular formula C26H28BNO2 and a molecular weight of 397.33 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)isoquinoline.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)isoquinoline |
|---|---|
| PubChem CID | 140826793 |
| Molecular Formula | C26H28BNO2 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)isoquinoline |
| SMILES | CC1(C)OB(c2cnc(-c3ccc4c(c3)C3CCC4C3)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C26H28BNO2/c1-25(2)26(3,4)30-27(29-25)23-15-28-24(21-8-6-5-7-20(21)23)18-11-12-19-16-9-10-17(13-16)22(19)14-18/h5-8,11-12,14-17H,9-10,13H2,1-4H3 |
| InChIKey | ABHOHRJCJDRAFN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|