C20H24BNO2 — CID 176676479
2-cyclopropyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 176676479) has the molecular formula C20H24BNO2 and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-cyclopropyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-cyclopropyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 176676479 |
| Molecular Formula | C20H24BNO2 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-cyclopropyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(C4CC4)nc3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H24BNO2/c1-19(2)20(3,4)24-21(23-19)17-10-7-14(8-11-17)16-9-12-18(22-13-16)15-5-6-15/h7-13,15H,5-6H2,1-4H3 |
| InChIKey | FENKBJYYVNJBGW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|