C18H26BNO2 — CID 140838308
2-(4,4-dimethylcyclopenten-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140838308) has the molecular formula C18H26BNO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclopenten-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(4,4-dimethylcyclopenten-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140838308 |
| Molecular Formula | C18H26BNO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-(4,4-dimethylcyclopenten-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)CC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C18H26BNO2/c1-16(2)10-9-13(11-16)15-8-7-14(12-20-15)19-21-17(3,4)18(5,6)22-19/h7-9,12H,10-11H2,1-6H3 |
| InChIKey | ZPSVPFVMGAZRQQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|