C18H27BO3 — CID 123412446
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexan-1-ol (PubChem CID 123412446) has the molecular formula C18H27BO3 and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexan-1-ol.
| Compound Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123412446 |
| Molecular Formula | C18H27BO3 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexan-1-ol |
| SMILES | CC1(C)OB(c2ccc(C3CCC(O)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H27BO3/c1-17(2)18(3,4)22-19(21-17)15-9-5-13(6-10-15)14-7-11-16(20)12-8-14/h5-6,9-10,14,16,20H,7-8,11-12H2,1-4H3 |
| InChIKey | ODWJAQMJCRYSGZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|