C20H28BO4- — CID 56971727
2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]acetate (PubChem CID 56971727) has the molecular formula C20H28BO4- and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]acetate.
| Compound Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 56971727 |
| Molecular Formula | C20H28BO4- |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]acetate |
| SMILES | CC1(C)OB(c2ccc(C3CCC(CC(=O)[O-])CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H29BO4/c1-19(2)20(3,4)25-21(24-19)17-11-9-16(10-12-17)15-7-5-14(6-8-15)13-18(22)23/h9-12,14-15H,5-8,13H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | MJAYQEJCAPRQLP-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|