C35H46B2O4 — CID 90385541
4,4,5,5-tetramethyl-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane (PubChem CID 90385541) has the molecular formula C35H46B2O4 and a molecular weight of 552.37 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90385541 |
| Molecular Formula | C35H46B2O4 |
| Molecular Weight | 552.37 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4c3C3CCC4C3)c3c2C2CCC3CC2)OC1(C)C |
| InChI | InChI=1S/C35H46B2O4/c1-32(2)33(3,4)39-36(38-32)26-17-15-24(28-20-9-11-21(12-10-20)30(26)28)25-16-18-27(31-23-14-13-22(19-23)29(25)31)37-40-34(5,6)35(7,8)41-37/h15-18,20-23H,9-14,19H2,1-8H3 |
| InChIKey | WHBMKGVDDBQIFI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.37 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|