C32H42B2O4 — CID 90054085
4,4,5,5-tetramethyl-2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-yl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane (PubChem CID 90054085) has the molecular formula C32H42B2O4 and a molecular weight of 512.31 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-yl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-yl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90054085 |
| Molecular Formula | C32H42B2O4 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-yl]-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4c3C3CCC4C3)c3c2CCC3)OC1(C)C |
| InChI | InChI=1S/C32H42B2O4/c1-29(2)30(3,4)36-33(35-29)25-16-14-22(21-10-9-11-23(21)25)24-15-17-26(28-20-13-12-19(18-20)27(24)28)34-37-31(5,6)32(7,8)38-34/h14-17,19-20H,9-13,18H2,1-8H3 |
| InChIKey | KUBUQOFPCGDRCW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|