C20H30BNO2 — CID 164662507
1-[4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (PubChem CID 164662507) has the molecular formula C20H30BNO2 and a molecular weight of 327.28 g/mol. Its IUPAC name is 1-[4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine.
| Compound Name | 1-[4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 164662507 |
| Molecular Formula | C20H30BNO2 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 1-[4-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| SMILES | CC1(C)OB(c2cc(C3CC3)ccc2N2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C20H30BNO2/c1-19(2)20(3,4)24-21(23-19)17-14-16(15-8-9-15)10-11-18(17)22-12-6-5-7-13-22/h10-11,14-15H,5-9,12-13H2,1-4H3 |
| InChIKey | OAHBVHGQNPYRJM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|