C15H19BFNO3 — CID 177227780
4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-2-one (PubChem CID 177227780) has the molecular formula C15H19BFNO3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-2-one.
| Compound Name | 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 177227780 |
| Molecular Formula | C15H19BFNO3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-2-one |
| SMILES | CC1(C)OB(c2ccc(C3CC(=O)N3)cc2F)OC1(C)C |
| InChI | InChI=1S/C15H19BFNO3/c1-14(2)15(3,4)21-16(20-14)10-6-5-9(7-11(10)17)12-8-13(19)18-12/h5-7,12H,8H2,1-4H3,(H,18,19) |
| InChIKey | CVLCRMYCRDDYLG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|