C32H42BBr3F2O4 — CID 161011295
4-bromo-2-(4-bromo-3-fluorophenyl)-5-ethyloxane;2-[4-(4-bromo-5-ethyloxan-2-yl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 161011295) has the molecular formula C32H42BBr3F2O4 and a molecular weight of 779.20 g/mol. Its IUPAC name is 4-bromo-2-(4-bromo-3-fluorophenyl)-5-ethyloxane;2-[4-(4-bromo-5-ethyloxan-2-yl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 4-bromo-2-(4-bromo-3-fluorophenyl)-5-ethyloxane;2-[4-(4-bromo-5-ethyloxan-2-yl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 161011295 |
| Molecular Formula | C32H42BBr3F2O4 |
| Molecular Weight | 779.20 g/mol |
| Exact Mass | 776.07 |
| IUPAC Name | 4-bromo-2-(4-bromo-3-fluorophenyl)-5-ethyloxane;2-[4-(4-bromo-5-ethyloxan-2-yl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC1COC(c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2)CC1Br.CCC1COC(c2ccc(Br)c(F)c2)CC1Br |
| InChI | InChI=1S/C19H27BBrFO3.C13H15Br2FO/c1-6-12-11-23-17(10-15(12)21)13-7-8-14(16(22)9-13)20-24-18(2,3)19(4,5)25-20;1-2-8-7-17-13(6-11(8)15)9-3-4-10(14)12(16)5-9/h7-9,12,15,17H,6,10-11H2,1-5H3;3-5,8,11,13H,2,6-7H2,1H3 |
| InChIKey | TXDNLJMESFDBGR-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.20 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|