C31H38BN3O2 — CID 90054183
2-[(2S,4S)-4-methylpyrrolidin-2-yl]-5-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazole (PubChem CID 90054183) has the molecular formula C31H38BN3O2 and a molecular weight of 495.48 g/mol. Its IUPAC name is 2-[(2S,4S)-4-methylpyrrolidin-2-yl]-5-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazole.
| Compound Name | 2-[(2S,4S)-4-methylpyrrolidin-2-yl]-5-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 90054183 |
| Molecular Formula | C31H38BN3O2 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 2-[(2S,4S)-4-methylpyrrolidin-2-yl]-5-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazole |
| SMILES | C[C@@H]1CN[C@H](c2ncc(-c3ccc(-c4ccc(B5OC(C)(C)C(C)(C)O5)c5c4C4CCC5C4)cc3)[nH]2)C1 |
| InChI | InChI=1S/C31H38BN3O2/c1-18-14-25(33-16-18)29-34-17-26(35-29)20-8-6-19(7-9-20)23-12-13-24(28-22-11-10-21(15-22)27(23)28)32-36-30(2,3)31(4,5)37-32/h6-9,12-13,17-18,21-22,25,33H,10-11,14-16H2,1-5H3,(H,34,35)/t18-,21?,22?,25-/m0/s1 |
| InChIKey | VDYRUKOUORDLMW-VODJVRFHSA-N |
| XLogP | 6.08 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|