C32H39BN2O2S — CID 160552458
5-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2-[(2R)-thiolan-2-yl]-1H-imidazole (PubChem CID 160552458) has the molecular formula C32H39BN2O2S and a molecular weight of 526.56 g/mol. Its IUPAC name is 5-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2-[(2R)-thiolan-2-yl]-1H-imidazole.
| Compound Name | 5-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2-[(2R)-thiolan-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 160552458 |
| Molecular Formula | C32H39BN2O2S |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 5-[4-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]phenyl]-2-[(2R)-thiolan-2-yl]-1H-imidazole |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4cnc([C@H]5CCCS5)[nH]4)cc3)c3c2CCC32CCCC2)OC1(C)C |
| InChI | InChI=1S/C32H39BN2O2S/c1-30(2)31(3,4)37-33(36-30)25-14-13-23(28-24(25)15-18-32(28)16-5-6-17-32)21-9-11-22(12-10-21)26-20-34-29(35-26)27-8-7-19-38-27/h9-14,20,27H,5-8,15-19H2,1-4H3,(H,34,35)/t27-/m1/s1 |
| InChIKey | YPTURFMEGCDRJZ-HHHXNRCGSA-N |
| XLogP | 7.37 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|