C30H47B2NO4 — CID 123993987
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]piperidine (PubChem CID 123993987) has the molecular formula C30H47B2NO4 and a molecular weight of 507.33 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]piperidine.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]piperidine |
|---|---|
| PubChem CID | 123993987 |
| Molecular Formula | C30H47B2NO4 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,1'-cyclopentane]-4-yl]piperidine |
| SMILES | CC1(C)OB(c2ccc(N3CCC(B4OC(C)(C)C(C)(C)O4)CC3)c3c2CCC32CCCC2)OC1(C)C |
| InChI | InChI=1S/C30H47B2NO4/c1-26(2)27(3,4)35-31(34-26)21-14-19-33(20-15-21)24-12-11-23(32-36-28(5,6)29(7,8)37-32)22-13-18-30(25(22)24)16-9-10-17-30/h11-12,21H,9-10,13-20H2,1-8H3 |
| InChIKey | SVYUGVDXLXWQCK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|