C21H34BNO5 — CID 170706091
4-(dimethoxymethyl)-1-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (PubChem CID 170706091) has the molecular formula C21H34BNO5 and a molecular weight of 391.32 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 170706091 |
| Molecular Formula | C21H34BNO5 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| SMILES | COc1cc(N2CCC(C(OC)OC)CC2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H34BNO5/c1-20(2)21(3,4)28-22(27-20)17-9-8-16(14-18(17)24-5)23-12-10-15(11-13-23)19(25-6)26-7/h8-9,14-15,19H,10-13H2,1-7H3 |
| InChIKey | DXELKRHZHMUUPI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|