C20H34BNO3 — CID 144637519
ethane;4-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine (PubChem CID 144637519) has the molecular formula C20H34BNO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is ethane;4-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine.
| Compound Name | ethane;4-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 144637519 |
| Molecular Formula | C20H34BNO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | ethane;4-methoxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine |
| SMILES | CC.COC1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C18H28BNO3.C2H6/c1-17(2)18(3,4)23-19(22-17)14-6-8-15(9-7-14)20-12-10-16(21-5)11-13-20;1-2/h6-9,16H,10-13H2,1-5H3;1-2H3 |
| InChIKey | XLDQZLYUQFTEQH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|