C15H22N2O4 — CID 171800424
methyl 5-[4-(dimethoxymethyl)piperidin-1-yl]pyridine-2-carboxylate (PubChem CID 171800424) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 5-[4-(dimethoxymethyl)piperidin-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[4-(dimethoxymethyl)piperidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171800424 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | methyl 5-[4-(dimethoxymethyl)piperidin-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC(C(OC)OC)CC2)cn1 |
| InChI | InChI=1S/C15H22N2O4/c1-19-14(18)13-5-4-12(10-16-13)17-8-6-11(7-9-17)15(20-2)21-3/h4-5,10-11,15H,6-9H2,1-3H3 |
| InChIKey | PGDRYPDRSAUWDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|