C16H21NO5 — CID 170545851
methyl 4-[(3R)-3-(dimethoxymethyl)pyrrolidin-1-yl]-2-formylbenzoate (PubChem CID 170545851) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 4-[(3R)-3-(dimethoxymethyl)pyrrolidin-1-yl]-2-formylbenzoate.
| Compound Name | methyl 4-[(3R)-3-(dimethoxymethyl)pyrrolidin-1-yl]-2-formylbenzoate |
|---|---|
| PubChem CID | 170545851 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl 4-[(3R)-3-(dimethoxymethyl)pyrrolidin-1-yl]-2-formylbenzoate |
| SMILES | COC(=O)c1ccc(N2CC[C@@H](C(OC)OC)C2)cc1C=O |
| InChI | InChI=1S/C16H21NO5/c1-20-15(19)14-5-4-13(8-12(14)10-18)17-7-6-11(9-17)16(21-2)22-3/h4-5,8,10-11,16H,6-7,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | ACQUTMKTDWUJQX-LLVKDONJSA-N |
| XLogP | 1.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|