C22H32BrNO5 — CID 171080185
methyl 2-bromo-4-[4-[4-(dimethoxymethyl)cyclohexyl]oxypiperidin-1-yl]benzoate (PubChem CID 171080185) has the molecular formula C22H32BrNO5 and a molecular weight of 470.40 g/mol. Its IUPAC name is methyl 2-bromo-4-[4-[4-(dimethoxymethyl)cyclohexyl]oxypiperidin-1-yl]benzoate.
| Compound Name | methyl 2-bromo-4-[4-[4-(dimethoxymethyl)cyclohexyl]oxypiperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 171080185 |
| Molecular Formula | C22H32BrNO5 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | methyl 2-bromo-4-[4-[4-(dimethoxymethyl)cyclohexyl]oxypiperidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(OC3CCC(C(OC)OC)CC3)CC2)cc1Br |
| InChI | InChI=1S/C22H32BrNO5/c1-26-21(25)19-9-6-16(14-20(19)23)24-12-10-18(11-13-24)29-17-7-4-15(5-8-17)22(27-2)28-3/h6,9,14-15,17-18,22H,4-5,7-8,10-13H2,1-3H3 |
| InChIKey | TYKDFAYFLJWQSD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|