C11H12F2N2O2 — CID 150740136
methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate (PubChem CID 150740136) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 150740136 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC(F)(F)C2)cn1 |
| InChI | InChI=1S/C11H12F2N2O2/c1-17-10(16)9-3-2-8(6-14-9)15-5-4-11(12,13)7-15/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | JTRBTGBGVCPXMD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |