methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate

C11H12F2N2O2 — CID 150740136

IUPACmethyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N2CCC(F)(F)C2)cn1
InChIInChI=1S/C11H12F2N2O2/c1-17-10(16)9-3-2-8(6-14-9)15-5-4-11(12,13)7-15/h2-3,6H,4-5,7H2,1H3
InChIKeyJTRBTGBGVCPXMD-UHFFFAOYSA-N
MW242.22 g/mol
LogP1.71
Rot. Bonds2

About methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate

methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate (PubChem CID 150740136) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate
PubChem CID150740136
Molecular FormulaC11H12F2N2O2
Molecular Weight242.22 g/mol
Exact Mass242.09
IUPAC Namemethyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N2CCC(F)(F)C2)cn1
InChIInChI=1S/C11H12F2N2O2/c1-17-10(16)9-3-2-8(6-14-9)15-5-4-11(12,13)7-15/h2-3,6H,4-5,7H2,1H3
InChIKeyJTRBTGBGVCPXMD-UHFFFAOYSA-N
XLogP1.71
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.22
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate (CID 150740136) is methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate is COC(=O)c1ccc(N2CCC(F)(F)C2)cn1.
What is the InChIKey of methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate?
The InChIKey is JTRBTGBGVCPXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O2/c1-17-10(16)9-3-2-8(6-14-9)15-5-4-11(12,13)7-15/h2-3,6H,4-5,7H2,1H3.
What are the key properties of methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate?
methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate has a molecular weight of 242.22 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3,3-difluoropyrrolidin-1-yl)pyridine-2-carboxylate is sourced from PubChem (CID 150740136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).