C18H26N4O4 — CID 176705502
3-[[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 176705502) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176705502 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-[[5-[4-(dimethoxymethyl)piperidin-1-yl]-2-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | COC(OC)C1CCN(c2ccc(NC3CCC(=O)NC3=O)nc2)CC1 |
| InChI | InChI=1S/C18H26N4O4/c1-25-18(26-2)12-7-9-22(10-8-12)13-3-5-15(19-11-13)20-14-4-6-16(23)21-17(14)24/h3,5,11-12,14,18H,4,6-10H2,1-2H3,(H,19,20)(H,21,23,24) |
| InChIKey | HBAUJUPSOYWMHB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|