C18H25N3O5 — CID 170954059
3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-oxo-1-pyridinyl]piperidine-2,6-dione (PubChem CID 170954059) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-oxo-1-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-oxo-1-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170954059 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-2-oxo-1-pyridinyl]piperidine-2,6-dione |
| SMILES | COC(OC)C1CCN(c2ccn(C3CCC(=O)NC3=O)c(=O)c2)CC1 |
| InChI | InChI=1S/C18H25N3O5/c1-25-18(26-2)12-5-8-20(9-6-12)13-7-10-21(16(23)11-13)14-3-4-15(22)19-17(14)24/h7,10-12,14,18H,3-6,8-9H2,1-2H3,(H,19,22,24) |
| InChIKey | SPFCMZMJDWVGKU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|