C37H42N6S2 — CID 144634275
CID 144634275 (PubChem CID 144634275) has the molecular formula C37H42N6S2 and a molecular weight of 634.92 g/mol.
| Compound Name | CID 144634275 |
|---|---|
| PubChem CID | 144634275 |
| Molecular Formula | C37H42N6S2 |
| Molecular Weight | 634.92 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | — |
| SMILES | CC1CNC(c2ncc(-c3ccc(-c4ccc(-c5ccc6nc(C7CC(C)CN7)[nH]c6c5)c5c4C4CCC4C5)cc3)[nH]2)C1.SS |
| InChI | InChI=1S/C37H40N6.H2S2/c1-20-13-32(38-17-20)36-40-19-34(43-36)23-5-3-22(4-6-23)27-11-10-26(29-15-24-7-9-28(24)35(27)29)25-8-12-30-31(16-25)42-37(41-30)33-14-21(2)18-39-33;1-2/h3-6,8,10-12,16,19-21,24,28,32-33,38-39H,7,9,13-15,17-18H2,1-2H3,(H,40,43)(H,41,42);1-2H |
| InChIKey | JYHVRSVBSJJKRP-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.92 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|