C26H34BBrO4 — CID 161483252
4-bromo-5,6,7,8-tetrahydronaphthalen-1-ol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 161483252) has the molecular formula C26H34BBrO4 and a molecular weight of 501.27 g/mol. Its IUPAC name is 4-bromo-5,6,7,8-tetrahydronaphthalen-1-ol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 4-bromo-5,6,7,8-tetrahydronaphthalen-1-ol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 161483252 |
| Molecular Formula | C26H34BBrO4 |
| Molecular Weight | 501.27 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 4-bromo-5,6,7,8-tetrahydronaphthalen-1-ol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CC1(C)OB(c2ccc(O)c3c2CCCC3)OC1(C)C.Oc1ccc(Br)c2c1CCCC2 |
| InChI | InChI=1S/C16H23BO3.C10H11BrO/c1-15(2)16(3,4)20-17(19-15)13-9-10-14(18)12-8-6-5-7-11(12)13;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h9-10,18H,5-8H2,1-4H3;5-6,12H,1-4H2 |
| InChIKey | WEQHMIQOFUBWFZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.27 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|