C24H32BBrN2O2 — CID 159106967
5-bromo-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 159106967) has the molecular formula C24H32BBrN2O2 and a molecular weight of 471.25 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 159106967 |
| Molecular Formula | C24H32BBrN2O2 |
| Molecular Weight | 471.25 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | CC1(C)OB(c2ccc3c(c2N)CCC3)OC1(C)C.Nc1c(Br)ccc2c1CCC2 |
| InChI | InChI=1S/C15H22BNO2.C9H10BrN/c1-14(2)15(3,4)19-16(18-14)12-9-8-10-6-5-7-11(10)13(12)17;10-8-5-4-6-2-1-3-7(6)9(8)11/h8-9H,5-7,17H2,1-4H3;4-5H,1-3,11H2 |
| InChIKey | KDZVSQXAGPXJBU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|