C16H26BClN2O2 — CID 133055783
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine;hydrochloride (PubChem CID 133055783) has the molecular formula C16H26BClN2O2 and a molecular weight of 324.66 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine;hydrochloride.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 133055783 |
| Molecular Formula | C16H26BClN2O2 |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine;hydrochloride |
| SMILES | CC1(C)OB(c2ccc(C3CNCCN3)cc2)OC1(C)C.Cl |
| InChI | InChI=1S/C16H25BN2O2.ClH/c1-15(2)16(3,4)21-17(20-15)13-7-5-12(6-8-13)14-11-18-9-10-19-14;/h5-8,14,18-19H,9-11H2,1-4H3;1H |
| InChIKey | WREOZDFLNPOCRA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|