C15H20BClO3 — CID 172645003
2-[3-chloro-4-(oxetan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 172645003) has the molecular formula C15H20BClO3 and a molecular weight of 294.59 g/mol. Its IUPAC name is 2-[3-chloro-4-(oxetan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-chloro-4-(oxetan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172645003 |
| Molecular Formula | C15H20BClO3 |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[3-chloro-4-(oxetan-3-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C3COC3)c(Cl)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BClO3/c1-14(2)15(3,4)20-16(19-14)11-5-6-12(13(17)7-11)10-8-18-9-10/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | BELHUIADRIQLKV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|