C17H24BNO3 — CID 59299005
N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanecarboxamide (PubChem CID 59299005) has the molecular formula C17H24BNO3 and a molecular weight of 301.19 g/mol. Its IUPAC name is N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 59299005 |
| Molecular Formula | C17H24BNO3 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanecarboxamide |
| SMILES | CC1(C)OB(c2cccc(CNC(=O)C3CC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H24BNO3/c1-16(2)17(3,4)22-18(21-16)14-7-5-6-12(10-14)11-19-15(20)13-8-9-13/h5-7,10,13H,8-9,11H2,1-4H3,(H,19,20) |
| InChIKey | SVZVWAUJCUKOQU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|