C20H27BN2O4 — CID 174065660
N-[3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide (PubChem CID 174065660) has the molecular formula C20H27BN2O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 174065660 |
| Molecular Formula | C20H27BN2O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropanecarboxamide |
| SMILES | CC1(C)OB(c2cc(NC(=O)C3CC3)cc(NC(=O)C3CC3)c2)OC1(C)C |
| InChI | InChI=1S/C20H27BN2O4/c1-19(2)20(3,4)27-21(26-19)14-9-15(22-17(24)12-5-6-12)11-16(10-14)23-18(25)13-7-8-13/h9-13H,5-8H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | AWIYZJJJLUVCCT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|