C40H51BN4O9 — CID 175853844
tert-butyl 3-(cyclopropanecarbonylamino)-5-hydroxyindole-1-carboxylate;tert-butyl 3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 175853844) has the molecular formula C40H51BN4O9 and a molecular weight of 742.68 g/mol. Its IUPAC name is tert-butyl 3-(cyclopropanecarbonylamino)-5-hydroxyindole-1-carboxylate;tert-butyl 3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(cyclopropanecarbonylamino)-5-hydroxyindole-1-carboxylate;tert-butyl 3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 175853844 |
| Molecular Formula | C40H51BN4O9 |
| Molecular Weight | 742.68 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | tert-butyl 3-(cyclopropanecarbonylamino)-5-hydroxyindole-1-carboxylate;tert-butyl 3-(cyclopropanecarbonylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(NC(=O)C2CC2)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21.CC(C)(C)OC(=O)n1cc(NC(=O)C2CC2)c2cc(O)ccc21 |
| InChI | InChI=1S/C23H31BN2O5.C17H20N2O4/c1-21(2,3)29-20(28)26-13-17(25-19(27)14-8-9-14)16-12-15(10-11-18(16)26)24-30-22(4,5)23(6,7)31-24;1-17(2,3)23-16(22)19-9-13(18-15(21)10-4-5-10)12-8-11(20)6-7-14(12)19/h10-14H,8-9H2,1-7H3,(H,25,27);6-10,20H,4-5H2,1-3H3,(H,18,21) |
| InChIKey | YBAXPFJEMUUFFV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|