C22H32BNO4 — CID 155662468
tert-butyl 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 155662468) has the molecular formula C22H32BNO4 and a molecular weight of 385.31 g/mol. Its IUPAC name is tert-butyl 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 155662468 |
| Molecular Formula | C22H32BNO4 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | CC(C)c1cn(C(=O)OC(C)(C)C)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C22H32BNO4/c1-14(2)17-13-24(19(25)26-20(3,4)5)18-11-10-15(12-16(17)18)23-27-21(6,7)22(8,9)28-23/h10-14H,1-9H3 |
| InChIKey | AXFWNELHLSBGDX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|