C29H37BN4O4 — CID 155662466
tert-butyl 2-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 155662466) has the molecular formula C29H37BN4O4 and a molecular weight of 516.45 g/mol. Its IUPAC name is tert-butyl 2-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 155662466 |
| Molecular Formula | C29H37BN4O4 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | tert-butyl 2-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | Cc1cc(-c2c(C(C)C)c3cc(B4OC(C)(C)C(C)(C)O4)ccc3n2C(=O)OC(C)(C)C)cn2ncnc12 |
| InChI | InChI=1S/C29H37BN4O4/c1-17(2)23-21-14-20(30-37-28(7,8)29(9,10)38-30)11-12-22(21)34(26(35)36-27(4,5)6)24(23)19-13-18(3)25-31-16-32-33(25)15-19/h11-17H,1-10H3 |
| InChIKey | NYJAIURAYXLBQC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|