C32H49BN2O7 — CID 155662493
tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxy-3-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 155662493) has the molecular formula C32H49BN2O7 and a molecular weight of 584.56 g/mol. Its IUPAC name is tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxy-3-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxy-3-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 155662493 |
| Molecular Formula | C32H49BN2O7 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxy-3-propan-2-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | CC(C)c1c(B2OC(C)(C)C(C)(C)O2)n(C(=O)OC(C)(C)C)c2ccc(OC3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C32H49BN2O7/c1-20(2)25-23-19-22(38-21-15-17-34(18-16-21)27(36)39-29(3,4)5)13-14-24(23)35(28(37)40-30(6,7)8)26(25)33-41-31(9,10)32(11,12)42-33/h13-14,19-21H,15-18H2,1-12H3 |
| InChIKey | IMVTXQHWWXASOU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 88.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|